C15H21NO8 — CID 163594806
[(6S,7aS)-6,7-diacetyloxy-1-methyl-2-oxo-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-5-yl]methyl acetate (PubChem CID 163594806) has the molecular formula C15H21NO8 and a molecular weight of 343.33 g/mol. Its IUPAC name is [(6S,7aS)-6,7-diacetyloxy-1-methyl-2-oxo-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-5-yl]methyl acetate.
| Compound Name | [(6S,7aS)-6,7-diacetyloxy-1-methyl-2-oxo-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 163594806 |
| Molecular Formula | C15H21NO8 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [(6S,7aS)-6,7-diacetyloxy-1-methyl-2-oxo-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-5-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC2CC(=O)N(C)[C@@H]2C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H21NO8/c1-7(17)21-6-11-14(22-8(2)18)15(23-9(3)19)13-10(24-11)5-12(20)16(13)4/h10-11,13-15H,5-6H2,1-4H3/t10?,11?,13-,14+,15?/m0/s1 |
| InChIKey | GSNKDSUXVXTIIW-GSCURDKXSA-N |
| XLogP | -0.59 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|