C14H17N7O2 — CID 163595031
1,2,3,4,5,6,8-heptaamino-7-methylxanthen-9-one (PubChem CID 163595031) has the molecular formula C14H17N7O2 and a molecular weight of 315.34 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptaamino-7-methylxanthen-9-one.
| Compound Name | 1,2,3,4,5,6,8-heptaamino-7-methylxanthen-9-one |
|---|---|
| PubChem CID | 163595031 |
| Molecular Formula | C14H17N7O2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1,2,3,4,5,6,8-heptaamino-7-methylxanthen-9-one |
| SMILES | Cc1c(N)c(N)c2oc3c(N)c(N)c(N)c(N)c3c(=O)c2c1N |
| InChI | InChI=1S/C14H17N7O2/c1-2-5(15)3-12(22)4-7(17)8(18)9(19)11(21)14(4)23-13(3)10(20)6(2)16/h15-21H2,1H3 |
| InChIKey | GSRWPJXHULSGLQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 212.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|