C20H27NO2 — CID 163595633
(2R,5S,9S)-9-amino-15-methoxy-2,5-dimethyltricyclo[11.4.0.05,9]heptadeca-1(13),7,14,16-tetraen-6-one (PubChem CID 163595633) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (2R,5S,9S)-9-amino-15-methoxy-2,5-dimethyltricyclo[11.4.0.05,9]heptadeca-1(13),7,14,16-tetraen-6-one.
| Compound Name | (2R,5S,9S)-9-amino-15-methoxy-2,5-dimethyltricyclo[11.4.0.05,9]heptadeca-1(13),7,14,16-tetraen-6-one |
|---|---|
| PubChem CID | 163595633 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (2R,5S,9S)-9-amino-15-methoxy-2,5-dimethyltricyclo[11.4.0.05,9]heptadeca-1(13),7,14,16-tetraen-6-one |
| SMILES | COc1ccc2c(c1)CCC[C@]1(N)C=CC(=O)[C@@]1(C)CC[C@H]2C |
| InChI | InChI=1S/C20H27NO2/c1-14-8-11-19(2)18(22)9-12-20(19,21)10-4-5-15-13-16(23-3)6-7-17(14)15/h6-7,9,12-14H,4-5,8,10-11,21H2,1-3H3/t14-,19-,20+/m1/s1 |
| InChIKey | GTEUZMIOFZQRKU-XMCHAPAWSA-N |
| XLogP | 3.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |