C9H14N2 — CID 163597242
methyl-[(3E,5S)-5-methylhepta-1,3,6-trien-3-yl]diazene (PubChem CID 163597242) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is methyl-[(3E,5S)-5-methylhepta-1,3,6-trien-3-yl]diazene.
| Compound Name | methyl-[(3E,5S)-5-methylhepta-1,3,6-trien-3-yl]diazene |
|---|---|
| PubChem CID | 163597242 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | methyl-[(3E,5S)-5-methylhepta-1,3,6-trien-3-yl]diazene |
| SMILES | C=CC(=C\[C@@H](C)C=C)/N=N/C |
| InChI | InChI=1S/C9H14N2/c1-5-8(3)7-9(6-2)11-10-4/h5-8H,1-2H2,3-4H3/b9-7+,11-10+/t8-/m0/s1 |
| InChIKey | GUMUGQBUEAXZFP-XICNDOBCSA-N |
| XLogP | 2.96 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|