C25H36N2O4 — CID 163597658
(1R,8S)-6-[(4aR,8aS)-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N,N-dipropyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide (PubChem CID 163597658) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is (1R,8S)-6-[(4aR,8aS)-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N,N-dipropyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1R,8S)-6-[(4aR,8aS)-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N,N-dipropyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 163597658 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | (1R,8S)-6-[(4aR,8aS)-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N,N-dipropyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
| SMILES | CCCN(CCC)C(=O)[C@@H]1CCN2C(=O)C(C(=O)C3CC=C[C@H]4CCCC[C@H]34)=C[C@]12O |
| InChI | InChI=1S/C25H36N2O4/c1-3-13-26(14-4-2)24(30)21-12-15-27-23(29)20(16-25(21,27)31)22(28)19-11-7-9-17-8-5-6-10-18(17)19/h7,9,16-19,21,31H,3-6,8,10-15H2,1-2H3/t17-,18+,19?,21+,25+/m1/s1 |
| InChIKey | GUWLTQCNOJRYMY-IKCSGPSGSA-N |
| XLogP | 3.06 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|