C18H26N4O — CID 163597665
1-[(4Z,6E)-6-amino-3-methylideneocta-4,6-dienyl]-3-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethyl]urea (PubChem CID 163597665) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[(4Z,6E)-6-amino-3-methylideneocta-4,6-dienyl]-3-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethyl]urea.
| Compound Name | 1-[(4Z,6E)-6-amino-3-methylideneocta-4,6-dienyl]-3-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 163597665 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-[(4Z,6E)-6-amino-3-methylideneocta-4,6-dienyl]-3-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethyl]urea |
| SMILES | [H]/N=C1/C=CC(CCNC(=O)NCCC(=C)/C=C\C(N)=C/C)=CC1 |
| InChI | InChI=1S/C18H26N4O/c1-3-16(19)7-4-14(2)10-12-21-18(23)22-13-11-15-5-8-17(20)9-6-15/h3-8,20H,2,9-13,19H2,1H3,(H2,21,22,23)/b7-4-,16-3+,20-17- |
| InChIKey | GUWPHCLRGQXENS-XOMUTGRRSA-N |
| XLogP | 2.95 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|