About 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate
3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate (PubChem CID 163597943) has the molecular formula C9H12NO2-
and a molecular weight of 166.20 g/mol. Its IUPAC name is 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate.
Molecular Properties
| Compound Name | 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate |
| PubChem CID | 163597943 |
| Molecular Formula | C9H12NO2- |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate |
| SMILES | CC1C=CC=C(N(C)O)C=C1[O-] |
| InChI | InChI=1S/C9H13NO2/c1-7-4-3-5-8(10(2)12)6-9(7)11/h3-7,11-12H,1-2H3/p-1 |
| InChIKey | DNZJZMFGPDIIFB-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate?
The IUPAC name of 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate (CID 163597943) is 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate.
What is the SMILES notation for 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate?
The canonical SMILES for 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate is CC1C=CC=C(N(C)O)C=C1[O-].
What is the InChIKey of 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate?
The InChIKey is DNZJZMFGPDIIFB-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H13NO2/c1-7-4-3-5-8(10(2)12)6-9(7)11/h3-7,11-12H,1-2H3/p-1.
What are the key properties of 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate?
3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate has a molecular weight of 166.20 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[hydroxy(methyl)amino]-7-methylcyclohepta-1,3,5-trien-1-olate is sourced from PubChem (CID 163597943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).