About 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine
7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 163597965) has the molecular formula C9H9FN2S
and a molecular weight of 196.25 g/mol. Its IUPAC name is 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine |
| PubChem CID | 163597965 |
| Molecular Formula | C9H9FN2S |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | CCCc1ncc2ncsc2c1F |
| InChI | InChI=1S/C9H9FN2S/c1-2-3-6-8(10)9-7(4-11-6)12-5-13-9/h4-5H,2-3H2,1H3 |
| InChIKey | GVCZRIVCRTZKKR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine?
The IUPAC name of 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine (CID 163597965) is 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine.
What is the SMILES notation for 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine?
The canonical SMILES for 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine is CCCc1ncc2ncsc2c1F.
What is the InChIKey of 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine?
The InChIKey is GVCZRIVCRTZKKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2S/c1-2-3-6-8(10)9-7(4-11-6)12-5-13-9/h4-5H,2-3H2,1H3.
What are the key properties of 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine?
7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine has a molecular weight of 196.25 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-6-propyl-[1,3]thiazolo[4,5-c]pyridine is sourced from PubChem (CID 163597965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).