About (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid
(Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid (PubChem CID 163598417) has the molecular formula C6H8F2O3
and a molecular weight of 166.12 g/mol. Its IUPAC name is (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid.
Molecular Properties
| Compound Name | (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid |
| PubChem CID | 163598417 |
| Molecular Formula | C6H8F2O3 |
| Molecular Weight | 166.12 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid |
| SMILES | O=C(O)C(O)/C(F)=C/CCF |
| InChI | InChI=1S/C6H8F2O3/c7-3-1-2-4(8)5(9)6(10)11/h2,5,9H,1,3H2,(H,10,11)/b4-2- |
| InChIKey | GVMCPYWDUUNSHZ-RQOWECAXSA-N |
| XLogP | 0.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.12 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid?
The IUPAC name of (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid (CID 163598417) is (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid.
What is the SMILES notation for (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid?
The canonical SMILES for (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid is O=C(O)C(O)/C(F)=C/CCF.
What is the InChIKey of (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid?
The InChIKey is GVMCPYWDUUNSHZ-RQOWECAXSA-N. The full InChI is InChI=1S/C6H8F2O3/c7-3-1-2-4(8)5(9)6(10)11/h2,5,9H,1,3H2,(H,10,11)/b4-2-.
What are the key properties of (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid?
(Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid has a molecular weight of 166.12 g/mol, XLogP of 0.64, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,6-difluoro-2-hydroxyhex-3-enoic acid is sourced from PubChem (CID 163598417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).