C24H30Cl2N4O4S — CID 163598443
[(3S,4R)-3-[(1R)-1-(4-aminophenoxy)ethyl]-4-(3,4-dichlorophenyl)pyrrolidin-1-yl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 163598443) has the molecular formula C24H30Cl2N4O4S and a molecular weight of 541.50 g/mol. Its IUPAC name is [(3S,4R)-3-[(1R)-1-(4-aminophenoxy)ethyl]-4-(3,4-dichlorophenyl)pyrrolidin-1-yl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [(3S,4R)-3-[(1R)-1-(4-aminophenoxy)ethyl]-4-(3,4-dichlorophenyl)pyrrolidin-1-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 163598443 |
| Molecular Formula | C24H30Cl2N4O4S |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | [(3S,4R)-3-[(1R)-1-(4-aminophenoxy)ethyl]-4-(3,4-dichlorophenyl)pyrrolidin-1-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | C[C@@H](Oc1ccc(N)cc1)[C@@H]1CN(C(=O)N2CCN(S(C)(=O)=O)CC2)C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H30Cl2N4O4S/c1-16(34-19-6-4-18(27)5-7-19)20-14-29(15-21(20)17-3-8-22(25)23(26)13-17)24(31)28-9-11-30(12-10-28)35(2,32)33/h3-8,13,16,20-21H,9-12,14-15,27H2,1-2H3/t16-,20+,21+/m1/s1 |
| InChIKey | GVMSMYNFDZRGIZ-CZAAIQMYSA-N |
| XLogP | 3.76 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|