About 6-methyl-4,5-dihydro-3H-1,6-naphthyridine
6-methyl-4,5-dihydro-3H-1,6-naphthyridine (PubChem CID 163598809) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 6-methyl-4,5-dihydro-3H-1,6-naphthyridine.
Molecular Properties
| Compound Name | 6-methyl-4,5-dihydro-3H-1,6-naphthyridine |
| PubChem CID | 163598809 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 6-methyl-4,5-dihydro-3H-1,6-naphthyridine |
| SMILES | CN1C=CC2=C(CCC=N2)C1 |
| InChI | InChI=1S/C9H12N2/c1-11-6-4-9-8(7-11)3-2-5-10-9/h4-6H,2-3,7H2,1H3 |
| InChIKey | GVVJYBNLJSEXDI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-4,5-dihydro-3H-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4,5-dihydro-3H-1,6-naphthyridine?
The IUPAC name of 6-methyl-4,5-dihydro-3H-1,6-naphthyridine (CID 163598809) is 6-methyl-4,5-dihydro-3H-1,6-naphthyridine.
What is the SMILES notation for 6-methyl-4,5-dihydro-3H-1,6-naphthyridine?
The canonical SMILES for 6-methyl-4,5-dihydro-3H-1,6-naphthyridine is CN1C=CC2=C(CCC=N2)C1.
What is the InChIKey of 6-methyl-4,5-dihydro-3H-1,6-naphthyridine?
The InChIKey is GVVJYBNLJSEXDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-11-6-4-9-8(7-11)3-2-5-10-9/h4-6H,2-3,7H2,1H3.
What are the key properties of 6-methyl-4,5-dihydro-3H-1,6-naphthyridine?
6-methyl-4,5-dihydro-3H-1,6-naphthyridine has a molecular weight of 148.21 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4,5-dihydro-3H-1,6-naphthyridine is sourced from PubChem (CID 163598809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).