C21H24ClINO- — CID 163599061
CID 163599061 (PubChem CID 163599061) has the molecular formula C21H24ClINO- and a molecular weight of 468.79 g/mol.
| Compound Name | CID 163599061 |
|---|---|
| PubChem CID | 163599061 |
| Molecular Formula | C21H24ClINO- |
| Molecular Weight | 468.79 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | — |
| SMILES | COCc1cc(/C(NC(C)(C)C)=C2/C[I-]2)ccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24ClINO/c1-21(2,3)24-20(19-12-23-19)15-7-10-18(16(11-15)13-25-4)14-5-8-17(22)9-6-14/h5-11,24H,12-13H2,1-4H3/q-1/b20-19+ |
| InChIKey | WBGHTQCYSWCTNP-FMQUCBEESA-N |
| XLogP | 2.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.79 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|