About 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one
2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one (PubChem CID 163599067) has the molecular formula C14H13F2N3O2
and a molecular weight of 293.27 g/mol. Its IUPAC name is 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one |
| PubChem CID | 163599067 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one |
| SMILES | [H]/N=C(\CC)c1c(N)[nH]c(-c2c(F)cccc2F)c(O)c1=O |
| InChI | InChI=1S/C14H13F2N3O2/c1-2-8(17)10-12(20)13(21)11(19-14(10)18)9-6(15)4-3-5-7(9)16/h3-5,17,21H,2H2,1H3,(H3,18,19,20)/b17-8+ |
| InChIKey | GWAUKQZYHFOCAJ-CAOOACKPSA-N |
| XLogP | 2.39 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one?
The IUPAC name of 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one (CID 163599067) is 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one.
What is the SMILES notation for 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one?
The canonical SMILES for 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one is [H]/N=C(\CC)c1c(N)[nH]c(-c2c(F)cccc2F)c(O)c1=O.
What is the InChIKey of 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one?
The InChIKey is GWAUKQZYHFOCAJ-CAOOACKPSA-N. The full InChI is InChI=1S/C14H13F2N3O2/c1-2-8(17)10-12(20)13(21)11(19-14(10)18)9-6(15)4-3-5-7(9)16/h3-5,17,21H,2H2,1H3,(H3,18,19,20)/b17-8+.
What are the key properties of 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one?
2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one has a molecular weight of 293.27 g/mol, XLogP of 2.39, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-propanimidoyl-1H-pyridin-4-one is sourced from PubChem (CID 163599067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).