C24H38N2O2S — CID 163599113
3-(cyclopropylidenemethyl)-4-[(dicyclohexylamino)-hydroxymethyl]-2,3,4,7,8,8a-hexahydropyrrolo[2,1-b][1,3]thiazin-6-one (PubChem CID 163599113) has the molecular formula C24H38N2O2S and a molecular weight of 418.65 g/mol. Its IUPAC name is 3-(cyclopropylidenemethyl)-4-[(dicyclohexylamino)-hydroxymethyl]-2,3,4,7,8,8a-hexahydropyrrolo[2,1-b][1,3]thiazin-6-one.
| Compound Name | 3-(cyclopropylidenemethyl)-4-[(dicyclohexylamino)-hydroxymethyl]-2,3,4,7,8,8a-hexahydropyrrolo[2,1-b][1,3]thiazin-6-one |
|---|---|
| PubChem CID | 163599113 |
| Molecular Formula | C24H38N2O2S |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 3-(cyclopropylidenemethyl)-4-[(dicyclohexylamino)-hydroxymethyl]-2,3,4,7,8,8a-hexahydropyrrolo[2,1-b][1,3]thiazin-6-one |
| SMILES | O=C1CCC2SCC(C=C3CC3)C(C(O)N(C3CCCCC3)C3CCCCC3)N12 |
| InChI | InChI=1S/C24H38N2O2S/c27-21-13-14-22-26(21)23(18(16-29-22)15-17-11-12-17)24(28)25(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h15,18-20,22-24,28H,1-14,16H2 |
| InChIKey | GWBYBPQZQZBELZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|