About ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate
ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate (PubChem CID 163599423) has the molecular formula C15H21N3S2
and a molecular weight of 307.49 g/mol. Its IUPAC name is ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate.
Molecular Properties
| Compound Name | ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate |
| PubChem CID | 163599423 |
| Molecular Formula | C15H21N3S2 |
| Molecular Weight | 307.49 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate |
| SMILES | [H]/N=C(/CCCc1ccc2c(c1)s/c(=N\[H])n2CC)SCC |
| InChI | InChI=1S/C15H21N3S2/c1-3-18-12-9-8-11(10-13(12)20-15(18)17)6-5-7-14(16)19-4-2/h8-10,16-17H,3-7H2,1-2H3/b16-14-,17-15- |
| InChIKey | GWHSHQKFKNDZFT-RYOQUFEFSA-N |
| XLogP | 4.26 |
| TPSA | 52.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate?
The IUPAC name of ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate (CID 163599423) is ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate.
What is the SMILES notation for ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate?
The canonical SMILES for ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate is [H]/N=C(/CCCc1ccc2c(c1)s/c(=N\[H])n2CC)SCC.
What is the InChIKey of ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate?
The InChIKey is GWHSHQKFKNDZFT-RYOQUFEFSA-N. The full InChI is InChI=1S/C15H21N3S2/c1-3-18-12-9-8-11(10-13(12)20-15(18)17)6-5-7-14(16)19-4-2/h8-10,16-17H,3-7H2,1-2H3/b16-14-,17-15-.
What are the key properties of ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate?
ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate has a molecular weight of 307.49 g/mol, XLogP of 4.26, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3-ethyl-2-imino-1,3-benzothiazol-6-yl)butanimidothioate is sourced from PubChem (CID 163599423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).