C20H17N3O — CID 163599718
2-[5-(2-phenylethynyl)-2-pyridinyl]-1,7,8,8a-tetrahydroimidazo[1,5-a]pyridin-3-one (PubChem CID 163599718) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-[5-(2-phenylethynyl)-2-pyridinyl]-1,7,8,8a-tetrahydroimidazo[1,5-a]pyridin-3-one.
| Compound Name | 2-[5-(2-phenylethynyl)-2-pyridinyl]-1,7,8,8a-tetrahydroimidazo[1,5-a]pyridin-3-one |
|---|---|
| PubChem CID | 163599718 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[5-(2-phenylethynyl)-2-pyridinyl]-1,7,8,8a-tetrahydroimidazo[1,5-a]pyridin-3-one |
| SMILES | O=C1N(c2ccc(C#Cc3ccccc3)cn2)CC2CCC=CN12 |
| InChI | InChI=1S/C20H17N3O/c24-20-22-13-5-4-8-18(22)15-23(20)19-12-11-17(14-21-19)10-9-16-6-2-1-3-7-16/h1-3,5-7,11-14,18H,4,8,15H2 |
| InChIKey | GWOVAYYSPZDTJN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|