C18H33F3N2O — CID 163600258
N-[(Z,2R,3S)-3-(2-aminoethyl)undec-8-en-2-yl]-N-(3,3,3-trifluoropropyl)acetamide (PubChem CID 163600258) has the molecular formula C18H33F3N2O and a molecular weight of 350.47 g/mol. Its IUPAC name is N-[(Z,2R,3S)-3-(2-aminoethyl)undec-8-en-2-yl]-N-(3,3,3-trifluoropropyl)acetamide.
| Compound Name | N-[(Z,2R,3S)-3-(2-aminoethyl)undec-8-en-2-yl]-N-(3,3,3-trifluoropropyl)acetamide |
|---|---|
| PubChem CID | 163600258 |
| Molecular Formula | C18H33F3N2O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | N-[(Z,2R,3S)-3-(2-aminoethyl)undec-8-en-2-yl]-N-(3,3,3-trifluoropropyl)acetamide |
| SMILES | CC/C=C\CCCC[C@@H](CCN)[C@@H](C)N(CCC(F)(F)F)C(C)=O |
| InChI | InChI=1S/C18H33F3N2O/c1-4-5-6-7-8-9-10-17(11-13-22)15(2)23(16(3)24)14-12-18(19,20)21/h5-6,15,17H,4,7-14,22H2,1-3H3/b6-5-/t15-,17+/m1/s1 |
| InChIKey | GWZCPTYTHPGYFB-FHYYHZITSA-N |
| XLogP | 4.67 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|