C36H39ClN6O2S — CID 163600287
(6-chloro-1H-indazol-3-yl)-[5-[2-[3-(1,9-diazatetracyclo[6.3.1.02,4.06,10]dodecan-9-yl)oxiran-2-yl]-3a,7a-dihydro-1-benzothiophen-7-yl]-6,9-diazatricyclo[4.3.1.03,8]decan-9-yl]methanone (PubChem CID 163600287) has the molecular formula C36H39ClN6O2S and a molecular weight of 655.27 g/mol. Its IUPAC name is (6-chloro-1H-indazol-3-yl)-[5-[2-[3-(1,9-diazatetracyclo[6.3.1.02,4.06,10]dodecan-9-yl)oxiran-2-yl]-3a,7a-dihydro-1-benzothiophen-7-yl]-6,9-diazatricyclo[4.3.1.03,8]decan-9-yl]methanone.
| Compound Name | (6-chloro-1H-indazol-3-yl)-[5-[2-[3-(1,9-diazatetracyclo[6.3.1.02,4.06,10]dodecan-9-yl)oxiran-2-yl]-3a,7a-dihydro-1-benzothiophen-7-yl]-6,9-diazatricyclo[4.3.1.03,8]decan-9-yl]methanone |
|---|---|
| PubChem CID | 163600287 |
| Molecular Formula | C36H39ClN6O2S |
| Molecular Weight | 655.27 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | (6-chloro-1H-indazol-3-yl)-[5-[2-[3-(1,9-diazatetracyclo[6.3.1.02,4.06,10]dodecan-9-yl)oxiran-2-yl]-3a,7a-dihydro-1-benzothiophen-7-yl]-6,9-diazatricyclo[4.3.1.03,8]decan-9-yl]methanone |
| SMILES | O=C(c1n[nH]c2cc(Cl)ccc12)N1C2CC3CC(C4=CC=CC5C=C(C6OC6N6C7CC8CC9CC9N(C7)CC86)SC45)N(C2)CC31 |
| InChI | InChI=1S/C36H39ClN6O2S/c37-21-4-5-24-26(12-21)38-39-32(24)35(44)42-22-8-20-10-28(41(13-22)15-29(20)42)25-3-1-2-17-11-31(46-34(17)25)33-36(45-33)43-23-7-18-6-19-9-27(19)40(14-23)16-30(18)43/h1-5,11-12,17-20,22-23,27-30,33-34,36H,6-10,13-16H2,(H,38,39) |
| InChIKey | GWZNVASTKBIWIX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|