About 6,7-dihydropyridazino[1,6-a]azepine-7-thiol
6,7-dihydropyridazino[1,6-a]azepine-7-thiol (PubChem CID 163600458) has the molecular formula C9H10N2S
and a molecular weight of 178.26 g/mol. Its IUPAC name is 6,7-dihydropyridazino[1,6-a]azepine-7-thiol.
Molecular Properties
| Compound Name | 6,7-dihydropyridazino[1,6-a]azepine-7-thiol |
| PubChem CID | 163600458 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 6,7-dihydropyridazino[1,6-a]azepine-7-thiol |
| SMILES | SC1C=CN2N=CC=CC2=CC1 |
| InChI | InChI=1S/C9H10N2S/c12-9-4-3-8-2-1-6-10-11(8)7-5-9/h1-3,5-7,9,12H,4H2 |
| InChIKey | GXDUWXNPFVIUKJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dihydropyridazino[1,6-a]azepine-7-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydropyridazino[1,6-a]azepine-7-thiol?
The IUPAC name of 6,7-dihydropyridazino[1,6-a]azepine-7-thiol (CID 163600458) is 6,7-dihydropyridazino[1,6-a]azepine-7-thiol.
What is the SMILES notation for 6,7-dihydropyridazino[1,6-a]azepine-7-thiol?
The canonical SMILES for 6,7-dihydropyridazino[1,6-a]azepine-7-thiol is SC1C=CN2N=CC=CC2=CC1.
What is the InChIKey of 6,7-dihydropyridazino[1,6-a]azepine-7-thiol?
The InChIKey is GXDUWXNPFVIUKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2S/c12-9-4-3-8-2-1-6-10-11(8)7-5-9/h1-3,5-7,9,12H,4H2.
What are the key properties of 6,7-dihydropyridazino[1,6-a]azepine-7-thiol?
6,7-dihydropyridazino[1,6-a]azepine-7-thiol has a molecular weight of 178.26 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydropyridazino[1,6-a]azepine-7-thiol is sourced from PubChem (CID 163600458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).