About (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol
(2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol (PubChem CID 163600476) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol |
| PubChem CID | 163600476 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol |
| SMILES | NC(/C=C\CO)=C/CNCCO |
| InChI | InChI=1S/C8H16N2O2/c9-8(2-1-6-11)3-4-10-5-7-12/h1-3,10-12H,4-7,9H2/b2-1-,8-3+ |
| InChIKey | GXEFAORZWMJODL-CKRIMZSVSA-N |
| XLogP | -1.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol?
The IUPAC name of (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol (CID 163600476) is (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol.
What is the SMILES notation for (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol?
The canonical SMILES for (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol is NC(/C=C\CO)=C/CNCCO.
What is the InChIKey of (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol?
The InChIKey is GXEFAORZWMJODL-CKRIMZSVSA-N. The full InChI is InChI=1S/C8H16N2O2/c9-8(2-1-6-11)3-4-10-5-7-12/h1-3,10-12H,4-7,9H2/b2-1-,8-3+.
What are the key properties of (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol?
(2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol has a molecular weight of 172.23 g/mol, XLogP of -1.04, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-4-amino-6-(2-hydroxyethylamino)hexa-2,4-dien-1-ol is sourced from PubChem (CID 163600476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).