C17H23N5OS — CID 163600924
3-[(3R)-3-aminopiperidin-1-yl]-6-methyl-4-[(5-methyl-2-sulfanylphenyl)methyl]-1,2,4-triazin-5-one (PubChem CID 163600924) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 3-[(3R)-3-aminopiperidin-1-yl]-6-methyl-4-[(5-methyl-2-sulfanylphenyl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-[(3R)-3-aminopiperidin-1-yl]-6-methyl-4-[(5-methyl-2-sulfanylphenyl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 163600924 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-[(3R)-3-aminopiperidin-1-yl]-6-methyl-4-[(5-methyl-2-sulfanylphenyl)methyl]-1,2,4-triazin-5-one |
| SMILES | Cc1ccc(S)c(Cn2c(N3CCC[C@@H](N)C3)nnc(C)c2=O)c1 |
| InChI | InChI=1S/C17H23N5OS/c1-11-5-6-15(24)13(8-11)9-22-16(23)12(2)19-20-17(22)21-7-3-4-14(18)10-21/h5-6,8,14,24H,3-4,7,9-10,18H2,1-2H3/t14-/m1/s1 |
| InChIKey | GXODNTZPODRTHY-CQSZACIVSA-N |
| XLogP | 1.52 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|