About (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol
(2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 163601018) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
Molecular Properties
| Compound Name | (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| PubChem CID | 163601018 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | C=C(C)C1C2OCC(O2)[C@@H](O)C1O |
| InChI | InChI=1S/C9H14O4/c1-4(2)6-8(11)7(10)5-3-12-9(6)13-5/h5-11H,1,3H2,2H3/t5?,6?,7-,8?,9?/m1/s1 |
| InChIKey | GXQFJCBCGINYJS-VXMMNQATSA-N |
| XLogP | -0.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol?
The IUPAC name of (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (CID 163601018) is (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
What is the SMILES notation for (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol?
The canonical SMILES for (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol is C=C(C)C1C2OCC(O2)[C@@H](O)C1O.
What is the InChIKey of (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol?
The InChIKey is GXQFJCBCGINYJS-VXMMNQATSA-N. The full InChI is InChI=1S/C9H14O4/c1-4(2)6-8(11)7(10)5-3-12-9(6)13-5/h5-11H,1,3H2,2H3/t5?,6?,7-,8?,9?/m1/s1.
What are the key properties of (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol?
(2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol has a molecular weight of 186.21 g/mol, XLogP of -0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-prop-1-en-2-yl-6,8-dioxabicyclo[3.2.1]octane-2,3-diol is sourced from PubChem (CID 163601018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).