C9H14N8S — CID 163601455
(4-methyl-1,2,4-triazol-3-yl)methyl N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]carbamimidothioate (PubChem CID 163601455) has the molecular formula C9H14N8S and a molecular weight of 266.33 g/mol. Its IUPAC name is (4-methyl-1,2,4-triazol-3-yl)methyl N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]carbamimidothioate.
| Compound Name | (4-methyl-1,2,4-triazol-3-yl)methyl N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]carbamimidothioate |
|---|---|
| PubChem CID | 163601455 |
| Molecular Formula | C9H14N8S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (4-methyl-1,2,4-triazol-3-yl)methyl N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]carbamimidothioate |
| SMILES | Cn1cnnc1C/N=C(\N)SCc1nncn1C |
| InChI | InChI=1S/C9H14N8S/c1-16-5-12-14-7(16)3-11-9(10)18-4-8-15-13-6-17(8)2/h5-6H,3-4H2,1-2H3,(H2,10,11) |
| InChIKey | GYABDFQEYKMLRL-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 99.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|