C50H45BrN2O5 — CID 163601737
2-bromo-1-phenylethanone;ethyl (Z)-3-anilino-3-phenylprop-2-enoate;ethyl 1,2,5-triphenylpyrrole-3-carboxylate (PubChem CID 163601737) has the molecular formula C50H45BrN2O5 and a molecular weight of 833.82 g/mol. Its IUPAC name is 2-bromo-1-phenylethanone;ethyl (Z)-3-anilino-3-phenylprop-2-enoate;ethyl 1,2,5-triphenylpyrrole-3-carboxylate.
| Compound Name | 2-bromo-1-phenylethanone;ethyl (Z)-3-anilino-3-phenylprop-2-enoate;ethyl 1,2,5-triphenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 163601737 |
| Molecular Formula | C50H45BrN2O5 |
| Molecular Weight | 833.82 g/mol |
| Exact Mass | 832.25 |
| IUPAC Name | 2-bromo-1-phenylethanone;ethyl (Z)-3-anilino-3-phenylprop-2-enoate;ethyl 1,2,5-triphenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)/C=C(\Nc1ccccc1)c1ccccc1.CCOC(=O)c1cc(-c2ccccc2)n(-c2ccccc2)c1-c1ccccc1.O=C(CBr)c1ccccc1 |
| InChI | InChI=1S/C25H21NO2.C17H17NO2.C8H7BrO/c1-2-28-25(27)22-18-23(19-12-6-3-7-13-19)26(21-16-10-5-11-17-21)24(22)20-14-8-4-9-15-20;1-2-20-17(19)13-16(14-9-5-3-6-10-14)18-15-11-7-4-8-12-15;9-6-8(10)7-4-2-1-3-5-7/h3-18H,2H2,1H3;3-13,18H,2H2,1H3;1-5H,6H2/b;16-13-; |
| InChIKey | GYFUEVCTUOCQEL-IZYDDMKMSA-N |
| XLogP | 11.95 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.82 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|