C12H30N6O6 — CID 163602092
1,4,7,10,13,16-hexahydroxy-1,4,7,10,13,16-hexazacyclooctadecane (PubChem CID 163602092) has the molecular formula C12H30N6O6 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexahydroxy-1,4,7,10,13,16-hexazacyclooctadecane.
| Compound Name | 1,4,7,10,13,16-hexahydroxy-1,4,7,10,13,16-hexazacyclooctadecane |
|---|---|
| PubChem CID | 163602092 |
| Molecular Formula | C12H30N6O6 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1,4,7,10,13,16-hexahydroxy-1,4,7,10,13,16-hexazacyclooctadecane |
| SMILES | ON1CCN(O)CCN(O)CCN(O)CCN(O)CCN(O)CC1 |
| InChI | InChI=1S/C12H30N6O6/c19-13-1-2-14(20)5-6-16(22)9-10-18(24)12-11-17(23)8-7-15(21)4-3-13/h19-24H,1-12H2 |
| InChIKey | GYNPZDABZGAFBM-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 140.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |