C28H21N4+ — CID 163602225
[8-[9-(2-aminophenyl)carbazol-3-yl]-1-iminonaphthalen-2-ylidene]azanium (PubChem CID 163602225) has the molecular formula C28H21N4+ and a molecular weight of 413.50 g/mol. Its IUPAC name is [8-[9-(2-aminophenyl)carbazol-3-yl]-1-iminonaphthalen-2-ylidene]azanium.
| Compound Name | [8-[9-(2-aminophenyl)carbazol-3-yl]-1-iminonaphthalen-2-ylidene]azanium |
|---|---|
| PubChem CID | 163602225 |
| Molecular Formula | C28H21N4+ |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [8-[9-(2-aminophenyl)carbazol-3-yl]-1-iminonaphthalen-2-ylidene]azanium |
| SMILES | [H]/N=C1\C(=[NH2+])C=Cc2cccc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3N)c21 |
| InChI | InChI=1S/C28H20N4/c29-22-9-2-4-11-26(22)32-24-10-3-1-7-20(24)21-16-18(13-15-25(21)32)19-8-5-6-17-12-14-23(30)28(31)27(17)19/h1-16,30-31H,29H2/p+1/b30-23?,31-28+ |
| InChIKey | GYQJRVANGXXTSF-OOGQQPPSSA-O |
| XLogP | 4.63 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|