C20H21F2N7 — CID 163603746
4-amino-N-(1-amino-2-methylpropylidene)-6-(2,4-difluorophenyl)-6-imino-5-pyrimidin-2-ylhexa-2,4-dienimidamide (PubChem CID 163603746) has the molecular formula C20H21F2N7 and a molecular weight of 397.43 g/mol. Its IUPAC name is 4-amino-N-(1-amino-2-methylpropylidene)-6-(2,4-difluorophenyl)-6-imino-5-pyrimidin-2-ylhexa-2,4-dienimidamide.
| Compound Name | 4-amino-N-(1-amino-2-methylpropylidene)-6-(2,4-difluorophenyl)-6-imino-5-pyrimidin-2-ylhexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 163603746 |
| Molecular Formula | C20H21F2N7 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-amino-N-(1-amino-2-methylpropylidene)-6-(2,4-difluorophenyl)-6-imino-5-pyrimidin-2-ylhexa-2,4-dienimidamide |
| SMILES | [H]/N=C(C=CC(N)=C(/C(=N/[H])c1ccc(F)cc1F)c1ncccn1)\N=C(\N)C(C)C |
| InChI | InChI=1S/C20H21F2N7/c1-11(2)19(26)29-16(24)7-6-15(23)17(20-27-8-3-9-28-20)18(25)13-5-4-12(21)10-14(13)22/h3-11,25H,23H2,1-2H3,(H3,24,26,29)/b7-6?,17-15?,25-18+ |
| InChIKey | GMTZGCYFDCGUAP-SUTFIDFJSA-N |
| XLogP | 3.04 |
| TPSA | 137.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|