C11H17N — CID 163604999
5-ethyl-N,5-dimethylcyclohepta-1,3,6-trien-1-amine (PubChem CID 163604999) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 5-ethyl-N,5-dimethylcyclohepta-1,3,6-trien-1-amine.
| Compound Name | 5-ethyl-N,5-dimethylcyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 163604999 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 5-ethyl-N,5-dimethylcyclohepta-1,3,6-trien-1-amine |
| SMILES | CCC1(C)C=CC=C(NC)C=C1 |
| InChI | InChI=1S/C11H17N/c1-4-11(2)8-5-6-10(12-3)7-9-11/h5-9,12H,4H2,1-3H3 |
| InChIKey | HAZFNQUHQNCLRA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |