About benzo[d][1,2]benzodiazepin-6-amine
benzo[d][1,2]benzodiazepin-6-amine (PubChem CID 163605435) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is benzo[d][1,2]benzodiazepin-6-amine.
Molecular Properties
| Compound Name | benzo[d][1,2]benzodiazepin-6-amine |
| PubChem CID | 163605435 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | benzo[d][1,2]benzodiazepin-6-amine |
| SMILES | NN1C=c2ccccc2=c2ccccc2=N1 |
| InChI | InChI=1S/C13H11N3/c14-16-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)15-16/h1-9H,14H2 |
| InChIKey | HBJADMOZMIEEBW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze benzo[d][1,2]benzodiazepin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[d][1,2]benzodiazepin-6-amine?
The IUPAC name of benzo[d][1,2]benzodiazepin-6-amine (CID 163605435) is benzo[d][1,2]benzodiazepin-6-amine.
What is the SMILES notation for benzo[d][1,2]benzodiazepin-6-amine?
The canonical SMILES for benzo[d][1,2]benzodiazepin-6-amine is NN1C=c2ccccc2=c2ccccc2=N1.
What is the InChIKey of benzo[d][1,2]benzodiazepin-6-amine?
The InChIKey is HBJADMOZMIEEBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c14-16-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)15-16/h1-9H,14H2.
What are the key properties of benzo[d][1,2]benzodiazepin-6-amine?
benzo[d][1,2]benzodiazepin-6-amine has a molecular weight of 209.25 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[d][1,2]benzodiazepin-6-amine is sourced from PubChem (CID 163605435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).