About (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine
(6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine (PubChem CID 163605776) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine.
Molecular Properties
| Compound Name | (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine |
| PubChem CID | 163605776 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine |
| SMILES | CNN1CC2(CC2)C[C@H]1C |
| InChI | InChI=1S/C8H16N2/c1-7-5-8(3-4-8)6-10(7)9-2/h7,9H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | HBQFTBBVKYAHAL-SSDOTTSWSA-N |
| XLogP | 1.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine?
The IUPAC name of (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine (CID 163605776) is (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine.
What is the SMILES notation for (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine?
The canonical SMILES for (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine is CNN1CC2(CC2)C[C@H]1C.
What is the InChIKey of (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine?
The InChIKey is HBQFTBBVKYAHAL-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H16N2/c1-7-5-8(3-4-8)6-10(7)9-2/h7,9H,3-6H2,1-2H3/t7-/m1/s1.
What are the key properties of (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine?
(6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine has a molecular weight of 140.23 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-N,6-dimethyl-5-azaspiro[2.4]heptan-5-amine is sourced from PubChem (CID 163605776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).