C15H21F7O5 — CID 163606133
[1,1,1-trifluoro-3-methoxy-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate (PubChem CID 163606133) has the molecular formula C15H21F7O5 and a molecular weight of 414.31 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-methoxy-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [1,1,1-trifluoro-3-methoxy-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 163606133 |
| Molecular Formula | C15H21F7O5 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [1,1,1-trifluoro-3-methoxy-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(OCCC(F)(F)C(C)(F)F)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C15H21F7O5/c1-6-11(2,3)9(23)27-14(10(24)25-5,15(20,21)22)26-8-7-13(18,19)12(4,16)17/h6-8H2,1-5H3 |
| InChIKey | IMUOXSOACAEHCD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|