C16H23F7O5 — CID 163606135
[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate (PubChem CID 163606135) has the molecular formula C16H23F7O5 and a molecular weight of 428.34 g/mol. Its IUPAC name is [3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 163606135 |
| Molecular Formula | C16H23F7O5 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(OCCC(F)(F)C(C)(F)F)(OC(=O)C(C)(C)CC)C(F)(F)F |
| InChI | InChI=1S/C16H23F7O5/c1-6-12(3,4)10(24)28-15(16(21,22)23,11(25)26-7-2)27-9-8-14(19,20)13(5,17)18/h6-9H2,1-5H3 |
| InChIKey | QXIFJGMMLGWXPX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|