About 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide
7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide (PubChem CID 163606286) has the molecular formula C17H18ClN3O3S
and a molecular weight of 379.87 g/mol. Its IUPAC name is 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide.
Molecular Properties
| Compound Name | 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide |
| PubChem CID | 163606286 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide |
| SMILES | Cc1ccccc1N1C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2N(C)C1C |
| InChI | InChI=1S/C17H18ClN3O3S/c1-10-6-4-5-7-14(10)21-11(2)20(3)15-9-13(18)16(25(19,23)24)8-12(15)17(21)22/h4-9,11H,1-3H3,(H2,19,23,24) |
| InChIKey | HCCCNKLFVAQKAI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide?
The IUPAC name of 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide (CID 163606286) is 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide.
What is the SMILES notation for 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide?
The canonical SMILES for 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide is Cc1ccccc1N1C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2N(C)C1C.
What is the InChIKey of 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide?
The InChIKey is HCCCNKLFVAQKAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN3O3S/c1-10-6-4-5-7-14(10)21-11(2)20(3)15-9-13(18)16(25(19,23)24)8-12(15)17(21)22/h4-9,11H,1-3H3,(H2,19,23,24).
What are the key properties of 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide?
7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide has a molecular weight of 379.87 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1,2-dimethyl-3-(2-methylphenyl)-4-oxo-2H-quinazoline-6-sulfonamide is sourced from PubChem (CID 163606286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).