About 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene
1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene (PubChem CID 163606470) has the molecular formula C18H20
and a molecular weight of 236.36 g/mol. Its IUPAC name is 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene.
Molecular Properties
| Compound Name | 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene |
| PubChem CID | 163606470 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene |
| SMILES | C=C(C)c1c(C(=C)C)c(C)c2ccccc2c1C |
| InChI | InChI=1S/C18H20/c1-11(2)17-13(5)15-9-7-8-10-16(15)14(6)18(17)12(3)4/h7-10H,1,3H2,2,4-6H3 |
| InChIKey | HCFYRHXQMRTAHS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene?
The IUPAC name of 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene (CID 163606470) is 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene.
What is the SMILES notation for 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene?
The canonical SMILES for 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene is C=C(C)c1c(C(=C)C)c(C)c2ccccc2c1C.
What is the InChIKey of 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene?
The InChIKey is HCFYRHXQMRTAHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20/c1-11(2)17-13(5)15-9-7-8-10-16(15)14(6)18(17)12(3)4/h7-10H,1,3H2,2,4-6H3.
What are the key properties of 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene?
1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene has a molecular weight of 236.36 g/mol, XLogP of 5.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2,3-bis(prop-1-en-2-yl)naphthalene is sourced from PubChem (CID 163606470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).