C19H15F2N5O2 — CID 163606500
(Z)-3-[5-(1,3-benzodioxol-5-ylmethyl)-1H-1,2,4-triazol-3-yl]-N'-(3,5-difluorophenyl)prop-2-enimidamide (PubChem CID 163606500) has the molecular formula C19H15F2N5O2 and a molecular weight of 383.36 g/mol. Its IUPAC name is (Z)-3-[5-(1,3-benzodioxol-5-ylmethyl)-1H-1,2,4-triazol-3-yl]-N'-(3,5-difluorophenyl)prop-2-enimidamide.
| Compound Name | (Z)-3-[5-(1,3-benzodioxol-5-ylmethyl)-1H-1,2,4-triazol-3-yl]-N'-(3,5-difluorophenyl)prop-2-enimidamide |
|---|---|
| PubChem CID | 163606500 |
| Molecular Formula | C19H15F2N5O2 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (Z)-3-[5-(1,3-benzodioxol-5-ylmethyl)-1H-1,2,4-triazol-3-yl]-N'-(3,5-difluorophenyl)prop-2-enimidamide |
| SMILES | NC(/C=C\c1n[nH]c(Cc2ccc3c(c2)OCO3)n1)=N\c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C19H15F2N5O2/c20-12-7-13(21)9-14(8-12)23-17(22)3-4-18-24-19(26-25-18)6-11-1-2-15-16(5-11)28-10-27-15/h1-5,7-9H,6,10H2,(H2,22,23)(H,24,25,26)/b4-3- |
| InChIKey | HCGUQOJQDTWLNJ-ARJAWSKDSA-N |
| XLogP | 3.10 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|