C13H12F3NO — CID 163606669
4-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazole (PubChem CID 163606669) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 4-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazole.
| Compound Name | 4-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 163606669 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazole |
| SMILES | CCc1coc(Cc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H12F3NO/c1-2-11-8-18-12(17-11)7-9-4-3-5-10(6-9)13(14,15)16/h3-6,8H,2,7H2,1H3 |
| InChIKey | HCJZIOFNFKIYDM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |