C60H61N — CID 163606752
9,9,10,10-tetramethyl-7-phenyl-N-(9,9,10,10-tetramethylphenanthren-2-yl)-N-(9,9,10,10-tetramethylphenanthren-3-yl)phenanthren-4-amine (PubChem CID 163606752) has the molecular formula C60H61N and a molecular weight of 796.16 g/mol. Its IUPAC name is 9,9,10,10-tetramethyl-7-phenyl-N-(9,9,10,10-tetramethylphenanthren-2-yl)-N-(9,9,10,10-tetramethylphenanthren-3-yl)phenanthren-4-amine.
| Compound Name | 9,9,10,10-tetramethyl-7-phenyl-N-(9,9,10,10-tetramethylphenanthren-2-yl)-N-(9,9,10,10-tetramethylphenanthren-3-yl)phenanthren-4-amine |
|---|---|
| PubChem CID | 163606752 |
| Molecular Formula | C60H61N |
| Molecular Weight | 796.16 g/mol |
| Exact Mass | 795.48 |
| IUPAC Name | 9,9,10,10-tetramethyl-7-phenyl-N-(9,9,10,10-tetramethylphenanthren-2-yl)-N-(9,9,10,10-tetramethylphenanthren-3-yl)phenanthren-4-amine |
| SMILES | CC1(C)c2ccccc2-c2cc(N(c3ccc4c(c3)C(C)(C)C(C)(C)c3ccccc3-4)c3cccc4c3-c3ccc(-c5ccccc5)cc3C(C)(C)C4(C)C)ccc2C1(C)C |
| InChI | InChI=1S/C60H61N/c1-55(2)48-26-19-17-24-43(48)46-36-40(31-34-49(46)57(55,5)6)61(41-30-33-44-42-23-16-18-25-47(42)56(3,4)60(11,12)52(44)37-41)53-28-20-27-50-54(53)45-32-29-39(38-21-14-13-15-22-38)35-51(45)59(9,10)58(50,7)8/h13-37H,1-12H3 |
| InChIKey | LVJPTUQIPQBHAB-UHFFFAOYSA-N |
| XLogP | 16.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.16 |
| LogP ≤ 5 | 16.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |