About 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone
1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone (PubChem CID 163607393) has the molecular formula C7H8INO
and a molecular weight of 249.05 g/mol. Its IUPAC name is 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone |
| PubChem CID | 163607393 |
| Molecular Formula | C7H8INO |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 248.97 |
| IUPAC Name | 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone |
| SMILES | C=Ic1ccc(C(C)=O)[nH]1 |
| InChI | InChI=1S/C7H8INO/c1-5(10)6-3-4-7(8-2)9-6/h3-4,9H,2H2,1H3 |
| InChIKey | HCYGFLQVTHSLOH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone?
The IUPAC name of 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone (CID 163607393) is 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone.
What is the SMILES notation for 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone?
The canonical SMILES for 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone is C=Ic1ccc(C(C)=O)[nH]1.
What is the InChIKey of 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone?
The InChIKey is HCYGFLQVTHSLOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8INO/c1-5(10)6-3-4-7(8-2)9-6/h3-4,9H,2H2,1H3.
What are the key properties of 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone?
1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone has a molecular weight of 249.05 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(methylidene-λ3-iodanyl)-1H-pyrrol-2-yl]ethanone is sourced from PubChem (CID 163607393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).