C28H31N5O2S — CID 163607583
5-[4-[(Z)-ethylidene(oxan-4-yl)-λ4-sulfanyl]phenyl]-3-[3-[4-(methylaminomethyl)phenyl]-1,2-oxazol-5-yl]pyrazin-2-amine (PubChem CID 163607583) has the molecular formula C28H31N5O2S and a molecular weight of 501.66 g/mol. Its IUPAC name is 5-[4-[(Z)-ethylidene(oxan-4-yl)-λ4-sulfanyl]phenyl]-3-[3-[4-(methylaminomethyl)phenyl]-1,2-oxazol-5-yl]pyrazin-2-amine.
| Compound Name | 5-[4-[(Z)-ethylidene(oxan-4-yl)-λ4-sulfanyl]phenyl]-3-[3-[4-(methylaminomethyl)phenyl]-1,2-oxazol-5-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 163607583 |
| Molecular Formula | C28H31N5O2S |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 5-[4-[(Z)-ethylidene(oxan-4-yl)-λ4-sulfanyl]phenyl]-3-[3-[4-(methylaminomethyl)phenyl]-1,2-oxazol-5-yl]pyrazin-2-amine |
| SMILES | C/C=S(\c1ccc(-c2cnc(N)c(-c3cc(-c4ccc(CNC)cc4)no3)n2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C28H31N5O2S/c1-3-36(23-12-14-34-15-13-23)22-10-8-21(9-11-22)25-18-31-28(29)27(32-25)26-16-24(33-35-26)20-6-4-19(5-7-20)17-30-2/h3-11,16,18,23,30H,12-15,17H2,1-2H3,(H2,29,31) |
| InChIKey | HDCGIXIPZLOTPS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|