C9H8O6 — CID 163608200
4,9,11-trioxatricyclo[5.5.0.02,6]dodecane-3,5,8-trione (PubChem CID 163608200) has the molecular formula C9H8O6 and a molecular weight of 212.16 g/mol. Its IUPAC name is 4,9,11-trioxatricyclo[5.5.0.02,6]dodecane-3,5,8-trione.
| Compound Name | 4,9,11-trioxatricyclo[5.5.0.02,6]dodecane-3,5,8-trione |
|---|---|
| PubChem CID | 163608200 |
| Molecular Formula | C9H8O6 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 4,9,11-trioxatricyclo[5.5.0.02,6]dodecane-3,5,8-trione |
| SMILES | O=C1OCOCC2C1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C9H8O6/c10-7-4-3(1-13-2-14-7)5-6(4)9(12)15-8(5)11/h3-6H,1-2H2 |
| InChIKey | HDPZAXMJLZNATH-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|