About 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione
5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione (PubChem CID 163609408) has the molecular formula C8H9NS2
and a molecular weight of 183.30 g/mol. Its IUPAC name is 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione.
Molecular Properties
| Compound Name | 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione |
| PubChem CID | 163609408 |
| Molecular Formula | C8H9NS2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione |
| SMILES | CC1C=c2[nH]c(=S)sc2=CC1 |
| InChI | InChI=1S/C8H9NS2/c1-5-2-3-7-6(4-5)9-8(10)11-7/h3-5H,2H2,1H3,(H,9,10) |
| InChIKey | HEPPDSFMEAPRDU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione?
The IUPAC name of 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione (CID 163609408) is 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione.
What is the SMILES notation for 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione?
The canonical SMILES for 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione is CC1C=c2[nH]c(=S)sc2=CC1.
What is the InChIKey of 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione?
The InChIKey is HEPPDSFMEAPRDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS2/c1-5-2-3-7-6(4-5)9-8(10)11-7/h3-5H,2H2,1H3,(H,9,10).
What are the key properties of 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione?
5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione has a molecular weight of 183.30 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5,6-dihydro-3H-1,3-benzothiazole-2-thione is sourced from PubChem (CID 163609408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).