About (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol
(3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol (PubChem CID 163609539) has the molecular formula C12H16F2N2O2S
and a molecular weight of 290.34 g/mol. Its IUPAC name is (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol.
Molecular Properties
| Compound Name | (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol |
| PubChem CID | 163609539 |
| Molecular Formula | C12H16F2N2O2S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol |
| SMILES | C=C(OCC)c1nc(C(O)N2CCC(F)(F)C2)cs1 |
| InChI | InChI=1S/C12H16F2N2O2S/c1-3-18-8(2)10-15-9(6-19-10)11(17)16-5-4-12(13,14)7-16/h6,11,17H,2-5,7H2,1H3 |
| InChIKey | HESDHCDVFXGLEW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol?
The IUPAC name of (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol (CID 163609539) is (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol.
What is the SMILES notation for (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol?
The canonical SMILES for (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol is C=C(OCC)c1nc(C(O)N2CCC(F)(F)C2)cs1.
What is the InChIKey of (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol?
The InChIKey is HESDHCDVFXGLEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N2O2S/c1-3-18-8(2)10-15-9(6-19-10)11(17)16-5-4-12(13,14)7-16/h6,11,17H,2-5,7H2,1H3.
What are the key properties of (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol?
(3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol has a molecular weight of 290.34 g/mol, XLogP of 2.48, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluoropyrrolidin-1-yl)-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanol is sourced from PubChem (CID 163609539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).