C14H17BrN5+ — CID 163609560
7-bromo-12-[(2S)-1,2,3-trimethylaziridin-1-ium-1-yl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaene (PubChem CID 163609560) has the molecular formula C14H17BrN5+ and a molecular weight of 335.23 g/mol. Its IUPAC name is 7-bromo-12-[(2S)-1,2,3-trimethylaziridin-1-ium-1-yl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaene.
| Compound Name | 7-bromo-12-[(2S)-1,2,3-trimethylaziridin-1-ium-1-yl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaene |
|---|---|
| PubChem CID | 163609560 |
| Molecular Formula | C14H17BrN5+ |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 7-bromo-12-[(2S)-1,2,3-trimethylaziridin-1-ium-1-yl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaene |
| SMILES | CC1[C@H](C)[N+]1(C)c1ncc2c(n1)N1CCN=C1C(Br)=C2 |
| InChI | InChI=1S/C14H17BrN5/c1-8-9(2)20(8,3)14-17-7-10-6-11(15)13-16-4-5-19(13)12(10)18-14/h6-9H,4-5H2,1-3H3/q+1/t8-,9?,20?/m0/s1 |
| InChIKey | IGVOACVJZSYPDO-WAXXGWJXSA-N |
| XLogP | 2.17 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|