C26H43F2NO6S — CID 163609805
2-[[(4R)-4-[(3R,5R,10S,13R,17R)-2,2-difluoro-3,7-dihydroxy-10,13-dimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid (PubChem CID 163609805) has the molecular formula C26H43F2NO6S and a molecular weight of 535.69 g/mol. Its IUPAC name is 2-[[(4R)-4-[(3R,5R,10S,13R,17R)-2,2-difluoro-3,7-dihydroxy-10,13-dimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(4R)-4-[(3R,5R,10S,13R,17R)-2,2-difluoro-3,7-dihydroxy-10,13-dimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 163609805 |
| Molecular Formula | C26H43F2NO6S |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 2-[[(4R)-4-[(3R,5R,10S,13R,17R)-2,2-difluoro-3,7-dihydroxy-10,13-dimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
| SMILES | C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CCC2C3C(O)C[C@@H]4C[C@@H](O)C(F)(F)C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C26H43F2NO6S/c1-15(4-7-22(32)29-10-11-36(33,34)35)17-5-6-18-23-19(8-9-24(17,18)2)25(3)14-26(27,28)21(31)13-16(25)12-20(23)30/h15-21,23,30-31H,4-14H2,1-3H3,(H,29,32)(H,33,34,35)/t15-,16-,17-,18?,19?,20?,21-,23?,24-,25+/m1/s1 |
| InChIKey | TXWCQZCDWZCEIT-NIMBSSDTSA-N |
| XLogP | 3.64 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|