C26H32F4N2O7 — CID 163609954
N-[(3S,7S,8R,9S)-7-[(4-fluorophenyl)methyl]-2-hydroxy-9-methyl-8-(4,4,4-trifluorobutoxy)-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide (PubChem CID 163609954) has the molecular formula C26H32F4N2O7 and a molecular weight of 560.54 g/mol. Its IUPAC name is N-[(3S,7S,8R,9S)-7-[(4-fluorophenyl)methyl]-2-hydroxy-9-methyl-8-(4,4,4-trifluorobutoxy)-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide.
| Compound Name | N-[(3S,7S,8R,9S)-7-[(4-fluorophenyl)methyl]-2-hydroxy-9-methyl-8-(4,4,4-trifluorobutoxy)-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 163609954 |
| Molecular Formula | C26H32F4N2O7 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | N-[(3S,7S,8R,9S)-7-[(4-fluorophenyl)methyl]-2-hydroxy-9-methyl-8-(4,4,4-trifluorobutoxy)-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC[C@H](Cc3ccc(F)cc3)[C@@H](OCCCC(F)(F)F)[C@H](C)OC2O)c1O |
| InChI | InChI=1S/C26H32F4N2O7/c1-15-23(38-11-3-9-26(28,29)30)17(12-16-4-6-18(27)7-5-16)13-37-14-19(25(35)39-15)32-24(34)21-22(33)20(36-2)8-10-31-21/h4-8,10,15,17,19,23,25,33,35H,3,9,11-14H2,1-2H3,(H,32,34)/t15-,17-,19-,23-,25?/m0/s1 |
| InChIKey | HFBASZAPGSDKFX-LMDOLSJGSA-N |
| XLogP | 3.37 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|