About (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone
(2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone (PubChem CID 163610019) has the molecular formula C18H18N2O
and a molecular weight of 278.36 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone.
Molecular Properties
| Compound Name | (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone |
| PubChem CID | 163610019 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)C2C=CC(n3ccnc3)=CC2)c1 |
| InChI | InChI=1S/C18H18N2O/c1-13-3-4-14(2)17(11-13)18(21)15-5-7-16(8-6-15)20-10-9-19-12-20/h3-5,7-12,15H,6H2,1-2H3 |
| InChIKey | HFCOBTHNNXFGKL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone?
The IUPAC name of (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone (CID 163610019) is (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone.
What is the SMILES notation for (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone?
The canonical SMILES for (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone is Cc1ccc(C)c(C(=O)C2C=CC(n3ccnc3)=CC2)c1.
What is the InChIKey of (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone?
The InChIKey is HFCOBTHNNXFGKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O/c1-13-3-4-14(2)17(11-13)18(21)15-5-7-16(8-6-15)20-10-9-19-12-20/h3-5,7-12,15H,6H2,1-2H3.
What are the key properties of (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone?
(2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone has a molecular weight of 278.36 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethylphenyl)-(4-imidazol-1-ylcyclohexa-2,4-dien-1-yl)methanone is sourced from PubChem (CID 163610019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).