About 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol
1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol (PubChem CID 163610309) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol.
Molecular Properties
| Compound Name | 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol |
| PubChem CID | 163610309 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol |
| SMILES | C=CC1=CC(OC(C)O)C(OCC)C=C1 |
| InChI | InChI=1S/C12H18O3/c1-4-10-6-7-11(14-5-2)12(8-10)15-9(3)13/h4,6-9,11-13H,1,5H2,2-3H3 |
| InChIKey | HFICLTIAKFBDTI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol?
The IUPAC name of 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol (CID 163610309) is 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol.
What is the SMILES notation for 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol?
The canonical SMILES for 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol is C=CC1=CC(OC(C)O)C(OCC)C=C1.
What is the InChIKey of 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol?
The InChIKey is HFICLTIAKFBDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-4-10-6-7-11(14-5-2)12(8-10)15-9(3)13/h4,6-9,11-13H,1,5H2,2-3H3.
What are the key properties of 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol?
1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol has a molecular weight of 210.27 g/mol, XLogP of 1.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethenyl-6-ethoxycyclohexa-2,4-dien-1-yl)oxyethanol is sourced from PubChem (CID 163610309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).