C17H21ClN2O — CID 163610725
(4S)-2-(2-chlorophenyl)-4-[(1R,6R)-6-methoxycyclohex-3-en-1-yl]-5-methyl-3,4-dihydropyrazole (PubChem CID 163610725) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is (4S)-2-(2-chlorophenyl)-4-[(1R,6R)-6-methoxycyclohex-3-en-1-yl]-5-methyl-3,4-dihydropyrazole.
| Compound Name | (4S)-2-(2-chlorophenyl)-4-[(1R,6R)-6-methoxycyclohex-3-en-1-yl]-5-methyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 163610725 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (4S)-2-(2-chlorophenyl)-4-[(1R,6R)-6-methoxycyclohex-3-en-1-yl]-5-methyl-3,4-dihydropyrazole |
| SMILES | CO[C@@H]1CC=CC[C@@H]1[C@H]1CN(c2ccccc2Cl)N=C1C |
| InChI | InChI=1S/C17H21ClN2O/c1-12-14(13-7-3-6-10-17(13)21-2)11-20(19-12)16-9-5-4-8-15(16)18/h3-6,8-9,13-14,17H,7,10-11H2,1-2H3/t13-,14+,17-/m1/s1 |
| InChIKey | HFRLCCKBZYOIID-JKIFEVAISA-N |
| XLogP | 4.13 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|