C27H38F2N4O — CID 163610729
(6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-[2-(5-phenyltetrazol-2-yl)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol (PubChem CID 163610729) has the molecular formula C27H38F2N4O and a molecular weight of 472.62 g/mol. Its IUPAC name is (6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-[2-(5-phenyltetrazol-2-yl)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-[2-(5-phenyltetrazol-2-yl)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 163610729 |
| Molecular Formula | C27H38F2N4O |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | (6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-[2-(5-phenyltetrazol-2-yl)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol |
| SMILES | C[C@H](CCC(F)(F)C(C)(C)O)[C@H]1CC[C@H]2/C(=C/Cn3nnc(-c4ccccc4)n3)CCC[C@]12C |
| InChI | InChI=1S/C27H38F2N4O/c1-19(14-17-27(28,29)25(2,3)34)22-12-13-23-20(11-8-16-26(22,23)4)15-18-33-31-24(30-32-33)21-9-6-5-7-10-21/h5-7,9-10,15,19,22-23,34H,8,11-14,16-18H2,1-4H3/b20-15+/t19-,22-,23+,26-/m1/s1 |
| InChIKey | RBHXXJSWBLDGDX-KWGQGYHHSA-N |
| XLogP | 6.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|