C9H11N3O — CID 163611236
4-(aziridin-1-yl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-one (PubChem CID 163611236) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 4-(aziridin-1-yl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-one.
| Compound Name | 4-(aziridin-1-yl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-one |
|---|---|
| PubChem CID | 163611236 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 4-(aziridin-1-yl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-one |
| SMILES | O=c1nc(N2CC2)c2c([nH]1)CCC2 |
| InChI | InChI=1S/C9H11N3O/c13-9-10-7-3-1-2-6(7)8(11-9)12-4-5-12/h1-5H2,(H,10,11,13) |
| InChIKey | HGCBVJCVCFPWDV-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 48.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|